C9H10N6O4S — CID 83082492
(2,4-dinitrophenyl)methyl N-(diaminomethylidene)carbamimidothioate (PubChem CID 83082492) has the molecular formula C9H10N6O4S and a molecular weight of 298.28 g/mol. Its IUPAC name is (2,4-dinitrophenyl)methyl N-(diaminomethylidene)carbamimidothioate.
| Compound Name | (2,4-dinitrophenyl)methyl N-(diaminomethylidene)carbamimidothioate |
|---|---|
| PubChem CID | 83082492 |
| Molecular Formula | C9H10N6O4S |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | (2,4-dinitrophenyl)methyl N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(\N=C(N)N)SCc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H10N6O4S/c10-8(11)13-9(12)20-4-5-1-2-6(14(16)17)3-7(5)15(18)19/h1-3H,4H2,(H5,10,11,12,13) |
| InChIKey | KIJHPOXLNMYLSB-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 174.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|