C16H17BrClN5O3S2 — CID 62706998
[2-[2-(carbamimidoylsulfanylmethyl)-4-chlorophenoxy]-5-nitrophenyl]methyl carbamimidothioate;hydrobromide (PubChem CID 62706998) has the molecular formula C16H17BrClN5O3S2 and a molecular weight of 506.84 g/mol. Its IUPAC name is [2-[2-(carbamimidoylsulfanylmethyl)-4-chlorophenoxy]-5-nitrophenyl]methyl carbamimidothioate;hydrobromide.
| Compound Name | [2-[2-(carbamimidoylsulfanylmethyl)-4-chlorophenoxy]-5-nitrophenyl]methyl carbamimidothioate;hydrobromide |
|---|---|
| PubChem CID | 62706998 |
| Molecular Formula | C16H17BrClN5O3S2 |
| Molecular Weight | 506.84 g/mol |
| Exact Mass | 504.96 |
| IUPAC Name | [2-[2-(carbamimidoylsulfanylmethyl)-4-chlorophenoxy]-5-nitrophenyl]methyl carbamimidothioate;hydrobromide |
| SMILES | Br.[H]/N=C(\N)SCc1cc(Cl)ccc1Oc1ccc([N+](=O)[O-])cc1CS/C(N)=N/[H] |
| InChI | InChI=1S/C16H16ClN5O3S2.BrH/c17-11-1-3-13(9(5-11)7-26-15(18)19)25-14-4-2-12(22(23)24)6-10(14)8-27-16(20)21;/h1-6H,7-8H2,(H3,18,19)(H3,20,21);1H |
| InChIKey | JPXSIYMBWGXBSL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 152.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.84 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|