C16H16ClN5O4S2 — CID 87559405
O-[[2-[2-(carbamimidoylsulfanylmethyl)-5-chlorophenoxy]-4-nitrophenyl]methyl] N-aminocarbamothioate (PubChem CID 87559405) has the molecular formula C16H16ClN5O4S2 and a molecular weight of 441.92 g/mol. Its IUPAC name is O-[[2-[2-(carbamimidoylsulfanylmethyl)-5-chlorophenoxy]-4-nitrophenyl]methyl] N-aminocarbamothioate.
| Compound Name | O-[[2-[2-(carbamimidoylsulfanylmethyl)-5-chlorophenoxy]-4-nitrophenyl]methyl] N-aminocarbamothioate |
|---|---|
| PubChem CID | 87559405 |
| Molecular Formula | C16H16ClN5O4S2 |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.03 |
| IUPAC Name | O-[[2-[2-(carbamimidoylsulfanylmethyl)-5-chlorophenoxy]-4-nitrophenyl]methyl] N-aminocarbamothioate |
| SMILES | [H]/N=C(\N)SCc1ccc(Cl)cc1Oc1cc([N+](=O)[O-])ccc1COC(=S)NN |
| InChI | InChI=1S/C16H16ClN5O4S2/c17-11-3-1-10(8-28-15(18)19)13(5-11)26-14-6-12(22(23)24)4-2-9(14)7-25-16(27)21-20/h1-6H,7-8,20H2,(H3,18,19)(H,21,27) |
| InChIKey | VKTMYSTVMLNDCX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 149.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|