C16H18Br2ClN5O4S2 — CID 87671995
O-[[2-[2-(carbamimidoylsulfanylmethyl)-5-chlorophenoxy]-4-nitrophenyl]methyl] N-aminocarbamothioate;dihydrobromide (PubChem CID 87671995) has the molecular formula C16H18Br2ClN5O4S2 and a molecular weight of 603.75 g/mol. Its IUPAC name is O-[[2-[2-(carbamimidoylsulfanylmethyl)-5-chlorophenoxy]-4-nitrophenyl]methyl] N-aminocarbamothioate;dihydrobromide.
| Compound Name | O-[[2-[2-(carbamimidoylsulfanylmethyl)-5-chlorophenoxy]-4-nitrophenyl]methyl] N-aminocarbamothioate;dihydrobromide |
|---|---|
| PubChem CID | 87671995 |
| Molecular Formula | C16H18Br2ClN5O4S2 |
| Molecular Weight | 603.75 g/mol |
| Exact Mass | 600.89 |
| IUPAC Name | O-[[2-[2-(carbamimidoylsulfanylmethyl)-5-chlorophenoxy]-4-nitrophenyl]methyl] N-aminocarbamothioate;dihydrobromide |
| SMILES | Br.Br.[H]/N=C(\N)SCc1ccc(Cl)cc1Oc1cc([N+](=O)[O-])ccc1COC(=S)NN |
| InChI | InChI=1S/C16H16ClN5O4S2.2BrH/c17-11-3-1-10(8-28-15(18)19)13(5-11)26-14-6-12(22(23)24)4-2-9(14)7-25-16(27)21-20;;/h1-6H,7-8,20H2,(H3,18,19)(H,21,27);2*1H |
| InChIKey | NQQWLBSANWZSMA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 149.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.75 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|