About 4-(carbamimidoylsulfanylmethyl)-3-nitrobenzoic acid;hydrobromide
4-(carbamimidoylsulfanylmethyl)-3-nitrobenzoic acid;hydrobromide (PubChem CID 158370051) has the molecular formula C9H10BrN3O4S
and a molecular weight of 336.17 g/mol. Its IUPAC name is 4-(carbamimidoylsulfanylmethyl)-3-nitrobenzoic acid;hydrobromide.
Molecular Properties
| Compound Name | 4-(carbamimidoylsulfanylmethyl)-3-nitrobenzoic acid;hydrobromide |
| PubChem CID | 158370051 |
| Molecular Formula | C9H10BrN3O4S |
| Molecular Weight | 336.17 g/mol |
| Exact Mass | 334.96 |
| IUPAC Name | 4-(carbamimidoylsulfanylmethyl)-3-nitrobenzoic acid;hydrobromide |
| SMILES | Br.[H]/N=C(\N)SCc1ccc(C(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9N3O4S.BrH/c10-9(11)17-4-6-2-1-5(8(13)14)3-7(6)12(15)16;/h1-3H,4H2,(H3,10,11)(H,13,14);1H |
| InChIKey | WRTAISAZGNAFHK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.17 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(carbamimidoylsulfanylmethyl)-3-nitrobenzoic acid;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(carbamimidoylsulfanylmethyl)-3-nitrobenzoic acid;hydrobromide?
The IUPAC name of 4-(carbamimidoylsulfanylmethyl)-3-nitrobenzoic acid;hydrobromide (CID 158370051) is 4-(carbamimidoylsulfanylmethyl)-3-nitrobenzoic acid;hydrobromide.
What is the SMILES notation for 4-(carbamimidoylsulfanylmethyl)-3-nitrobenzoic acid;hydrobromide?
The canonical SMILES for 4-(carbamimidoylsulfanylmethyl)-3-nitrobenzoic acid;hydrobromide is Br.[H]/N=C(\N)SCc1ccc(C(=O)O)cc1[N+](=O)[O-].
What is the InChIKey of 4-(carbamimidoylsulfanylmethyl)-3-nitrobenzoic acid;hydrobromide?
The InChIKey is WRTAISAZGNAFHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O4S.BrH/c10-9(11)17-4-6-2-1-5(8(13)14)3-7(6)12(15)16;/h1-3H,4H2,(H3,10,11)(H,13,14);1H.
What are the key properties of 4-(carbamimidoylsulfanylmethyl)-3-nitrobenzoic acid;hydrobromide?
4-(carbamimidoylsulfanylmethyl)-3-nitrobenzoic acid;hydrobromide has a molecular weight of 336.17 g/mol, XLogP of 2.00, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(carbamimidoylsulfanylmethyl)-3-nitrobenzoic acid;hydrobromide is sourced from PubChem (CID 158370051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).