C16H18Br2FN5O2S3 — CID 69238113
[2-[2-(carbamimidoylsulfanylmethyl)-4-fluorophenyl]sulfanyl-3-nitrophenyl]methyl carbamimidothioate;dihydrobromide (PubChem CID 69238113) has the molecular formula C16H18Br2FN5O2S3 and a molecular weight of 587.36 g/mol. Its IUPAC name is [2-[2-(carbamimidoylsulfanylmethyl)-4-fluorophenyl]sulfanyl-3-nitrophenyl]methyl carbamimidothioate;dihydrobromide.
| Compound Name | [2-[2-(carbamimidoylsulfanylmethyl)-4-fluorophenyl]sulfanyl-3-nitrophenyl]methyl carbamimidothioate;dihydrobromide |
|---|---|
| PubChem CID | 69238113 |
| Molecular Formula | C16H18Br2FN5O2S3 |
| Molecular Weight | 587.36 g/mol |
| Exact Mass | 584.90 |
| IUPAC Name | [2-[2-(carbamimidoylsulfanylmethyl)-4-fluorophenyl]sulfanyl-3-nitrophenyl]methyl carbamimidothioate;dihydrobromide |
| SMILES | Br.Br.[H]/N=C(\N)SCc1cc(F)ccc1Sc1c(CS/C(N)=N/[H])cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16FN5O2S3.2BrH/c17-11-4-5-13(10(6-11)8-26-16(20)21)27-14-9(7-25-15(18)19)2-1-3-12(14)22(23)24;;/h1-6H,7-8H2,(H3,18,19)(H3,20,21);2*1H |
| InChIKey | WPGCMLWUHSJILK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.36 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|