C16H20Br2N4S3 — CID 69046479
[2-[2-(carbamimidoylsulfanylmethyl)phenyl]sulfanylphenyl]methyl carbamimidothioate;dihydrobromide (PubChem CID 69046479) has the molecular formula C16H20Br2N4S3 and a molecular weight of 524.37 g/mol. Its IUPAC name is [2-[2-(carbamimidoylsulfanylmethyl)phenyl]sulfanylphenyl]methyl carbamimidothioate;dihydrobromide.
| Compound Name | [2-[2-(carbamimidoylsulfanylmethyl)phenyl]sulfanylphenyl]methyl carbamimidothioate;dihydrobromide |
|---|---|
| PubChem CID | 69046479 |
| Molecular Formula | C16H20Br2N4S3 |
| Molecular Weight | 524.37 g/mol |
| Exact Mass | 521.92 |
| IUPAC Name | [2-[2-(carbamimidoylsulfanylmethyl)phenyl]sulfanylphenyl]methyl carbamimidothioate;dihydrobromide |
| SMILES | Br.Br.[H]/N=C(\N)SCc1ccccc1Sc1ccccc1CS/C(N)=N/[H] |
| InChI | InChI=1S/C16H18N4S3.2BrH/c17-15(18)21-9-11-5-1-3-7-13(11)23-14-8-4-2-6-12(14)10-22-16(19)20;;/h1-8H,9-10H2,(H3,17,18)(H3,19,20);2*1H |
| InChIKey | OWBIFXVARGKMDB-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.37 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|