C20H26N4S — CID 25071816
4-[2-[2-(4-amino-4-iminobutyl)phenyl]sulfanylphenyl]butanimidamide (PubChem CID 25071816) has the molecular formula C20H26N4S and a molecular weight of 354.52 g/mol. Its IUPAC name is 4-[2-[2-(4-amino-4-iminobutyl)phenyl]sulfanylphenyl]butanimidamide.
| Compound Name | 4-[2-[2-(4-amino-4-iminobutyl)phenyl]sulfanylphenyl]butanimidamide |
|---|---|
| PubChem CID | 25071816 |
| Molecular Formula | C20H26N4S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 4-[2-[2-(4-amino-4-iminobutyl)phenyl]sulfanylphenyl]butanimidamide |
| SMILES | [H]/N=C(\N)CCCc1ccccc1Sc1ccccc1CCC/C(N)=N/[H] |
| InChI | InChI=1S/C20H26N4S/c21-19(22)13-5-9-15-7-1-3-11-17(15)25-18-12-4-2-8-16(18)10-6-14-20(23)24/h1-4,7-8,11-12H,5-6,9-10,13-14H2,(H3,21,22)(H3,23,24) |
| InChIKey | FTJUUHYWNYVKEX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|