C16H20N6S — CID 44608409
2-[[2-[2-[(diaminomethylideneamino)methyl]phenyl]sulfanylphenyl]methyl]guanidine (PubChem CID 44608409) has the molecular formula C16H20N6S and a molecular weight of 328.45 g/mol. Its IUPAC name is 2-[[2-[2-[(diaminomethylideneamino)methyl]phenyl]sulfanylphenyl]methyl]guanidine.
| Compound Name | 2-[[2-[2-[(diaminomethylideneamino)methyl]phenyl]sulfanylphenyl]methyl]guanidine |
|---|---|
| PubChem CID | 44608409 |
| Molecular Formula | C16H20N6S |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 2-[[2-[2-[(diaminomethylideneamino)methyl]phenyl]sulfanylphenyl]methyl]guanidine |
| SMILES | NC(N)=NCc1ccccc1Sc1ccccc1CN=C(N)N |
| InChI | InChI=1S/C16H20N6S/c17-15(18)21-9-11-5-1-3-7-13(11)23-14-8-4-2-6-12(14)10-22-16(19)20/h1-8H,9-10H2,(H4,17,18,21)(H4,19,20,22) |
| InChIKey | KEBXKALGJXAQTF-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|