C15H18N2S — CID 54965805
5-naphthalen-2-ylsulfanylpentanimidamide (PubChem CID 54965805) has the molecular formula C15H18N2S and a molecular weight of 258.39 g/mol. Its IUPAC name is 5-naphthalen-2-ylsulfanylpentanimidamide.
| Compound Name | 5-naphthalen-2-ylsulfanylpentanimidamide |
|---|---|
| PubChem CID | 54965805 |
| Molecular Formula | C15H18N2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 5-naphthalen-2-ylsulfanylpentanimidamide |
| SMILES | [H]/N=C(\N)CCCCSc1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H18N2S/c16-15(17)7-3-4-10-18-14-9-8-12-5-1-2-6-13(12)11-14/h1-2,5-6,8-9,11H,3-4,7,10H2,(H3,16,17) |
| InChIKey | OKJQKCGCUWNSGS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|