C11H14N2O2 — CID 140979428
4-(2-carbamimidoylphenyl)butanoic acid (PubChem CID 140979428) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 4-(2-carbamimidoylphenyl)butanoic acid.
| Compound Name | 4-(2-carbamimidoylphenyl)butanoic acid |
|---|---|
| PubChem CID | 140979428 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 4-(2-carbamimidoylphenyl)butanoic acid |
| SMILES | [H]/N=C(\N)c1ccccc1CCCC(=O)O |
| InChI | InChI=1S/C11H14N2O2/c12-11(13)9-6-2-1-4-8(9)5-3-7-10(14)15/h1-2,4,6H,3,5,7H2,(H3,12,13)(H,14,15) |
| InChIKey | FMMXXVYWWVXMQY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 87.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|