C24H32N4 — CID 175997207
2-[2-[(1S,3R)-3-[2-(2-carbamimidoylphenyl)ethyl]cyclohexyl]ethyl]benzenecarboximidamide (PubChem CID 175997207) has the molecular formula C24H32N4 and a molecular weight of 376.55 g/mol. Its IUPAC name is 2-[2-[(1S,3R)-3-[2-(2-carbamimidoylphenyl)ethyl]cyclohexyl]ethyl]benzenecarboximidamide.
| Compound Name | 2-[2-[(1S,3R)-3-[2-(2-carbamimidoylphenyl)ethyl]cyclohexyl]ethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 175997207 |
| Molecular Formula | C24H32N4 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | 2-[2-[(1S,3R)-3-[2-(2-carbamimidoylphenyl)ethyl]cyclohexyl]ethyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccccc1CC[C@H]1CCC[C@@H](CCc2ccccc2/C(N)=N/[H])C1 |
| InChI | InChI=1S/C24H32N4/c25-23(26)21-10-3-1-8-19(21)14-12-17-6-5-7-18(16-17)13-15-20-9-2-4-11-22(20)24(27)28/h1-4,8-11,17-18H,5-7,12-16H2,(H3,25,26)(H3,27,28)/t17-,18+ |
| InChIKey | SJXZDFVBLSDNGP-HDICACEKSA-N |
| XLogP | 4.63 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|