C13H19N3 — CID 43267235
2-[cyclopentyl(methyl)amino]benzenecarboximidamide (PubChem CID 43267235) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 2-[cyclopentyl(methyl)amino]benzenecarboximidamide.
| Compound Name | 2-[cyclopentyl(methyl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 43267235 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 2-[cyclopentyl(methyl)amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccccc1N(C)C1CCCC1 |
| InChI | InChI=1S/C13H19N3/c1-16(10-6-2-3-7-10)12-9-5-4-8-11(12)13(14)15/h4-5,8-10H,2-3,6-7H2,1H3,(H3,14,15) |
| InChIKey | XXCYYXOFBZZQMJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|