C12H14F3N3 — CID 43265029
2-[cyclopropyl(methyl)amino]-5-(trifluoromethyl)benzenecarboximidamide (PubChem CID 43265029) has the molecular formula C12H14F3N3 and a molecular weight of 257.26 g/mol. Its IUPAC name is 2-[cyclopropyl(methyl)amino]-5-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | 2-[cyclopropyl(methyl)amino]-5-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 43265029 |
| Molecular Formula | C12H14F3N3 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 2-[cyclopropyl(methyl)amino]-5-(trifluoromethyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C(F)(F)F)ccc1N(C)C1CC1 |
| InChI | InChI=1S/C12H14F3N3/c1-18(8-3-4-8)10-5-2-7(12(13,14)15)6-9(10)11(16)17/h2,5-6,8H,3-4H2,1H3,(H3,16,17) |
| InChIKey | VLZBYKZFSAMCMP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|