C10H12F3N3 — CID 62201411
2-(ethylamino)-5-(trifluoromethyl)benzenecarboximidamide (PubChem CID 62201411) has the molecular formula C10H12F3N3 and a molecular weight of 231.22 g/mol. Its IUPAC name is 2-(ethylamino)-5-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | 2-(ethylamino)-5-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 62201411 |
| Molecular Formula | C10H12F3N3 |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 2-(ethylamino)-5-(trifluoromethyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C(F)(F)F)ccc1NCC |
| InChI | InChI=1S/C10H12F3N3/c1-2-16-8-4-3-6(10(11,12)13)5-7(8)9(14)15/h3-5,16H,2H2,1H3,(H3,14,15) |
| InChIKey | DENGTKDYKKLDFN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|