C13H17F3N2O — CID 43275185
2-pentoxy-5-(trifluoromethyl)benzenecarboximidamide (PubChem CID 43275185) has the molecular formula C13H17F3N2O and a molecular weight of 274.29 g/mol. Its IUPAC name is 2-pentoxy-5-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | 2-pentoxy-5-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 43275185 |
| Molecular Formula | C13H17F3N2O |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 2-pentoxy-5-(trifluoromethyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C(F)(F)F)ccc1OCCCCC |
| InChI | InChI=1S/C13H17F3N2O/c1-2-3-4-7-19-11-6-5-9(13(14,15)16)8-10(11)12(17)18/h5-6,8H,2-4,7H2,1H3,(H3,17,18) |
| InChIKey | WQIXUGSLTLFEPB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|