C11H17N3O — CID 62334639
2-[2-hydroxypropyl(methyl)amino]benzenecarboximidamide (PubChem CID 62334639) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 2-[2-hydroxypropyl(methyl)amino]benzenecarboximidamide.
| Compound Name | 2-[2-hydroxypropyl(methyl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 62334639 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 2-[2-hydroxypropyl(methyl)amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccccc1N(C)CC(C)O |
| InChI | InChI=1S/C11H17N3O/c1-8(15)7-14(2)10-6-4-3-5-9(10)11(12)13/h3-6,8,15H,7H2,1-2H3,(H3,12,13) |
| InChIKey | BSJUZIGJPKYJTO-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|