C28H38N2 — CID 163272018
4-[2-[3-[2-(4-cyclopentylphenyl)ethyl]cyclohexyl]ethyl]benzenecarboximidamide (PubChem CID 163272018) has the molecular formula C28H38N2 and a molecular weight of 402.63 g/mol. Its IUPAC name is 4-[2-[3-[2-(4-cyclopentylphenyl)ethyl]cyclohexyl]ethyl]benzenecarboximidamide.
| Compound Name | 4-[2-[3-[2-(4-cyclopentylphenyl)ethyl]cyclohexyl]ethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 163272018 |
| Molecular Formula | C28H38N2 |
| Molecular Weight | 402.63 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | 4-[2-[3-[2-(4-cyclopentylphenyl)ethyl]cyclohexyl]ethyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CCC2CCCC(CCc3ccc(C4CCCC4)cc3)C2)cc1 |
| InChI | InChI=1S/C28H38N2/c29-28(30)27-18-14-22(15-19-27)9-11-24-5-3-4-23(20-24)10-8-21-12-16-26(17-13-21)25-6-1-2-7-25/h12-19,23-25H,1-11,20H2,(H3,29,30) |
| InChIKey | XUUFXTFYZPXQGS-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.63 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|