C25H30FN3O2 — CID 159292459
cis-(1R,3S)-N-[(2S)-5-(4-carbamimidoylphenyl)-3-oxopentan-2-yl]-3-(4-fluorophenyl)cyclohexane-1-carboxamide (PubChem CID 159292459) has the molecular formula C25H30FN3O2 and a molecular weight of 423.53 g/mol. Its IUPAC name is cis-(1R,3S)-N-[(2S)-5-(4-carbamimidoylphenyl)-3-oxopentan-2-yl]-3-(4-fluorophenyl)cyclohexane-1-carboxamide.
| Compound Name | cis-(1R,3S)-N-[(2S)-5-(4-carbamimidoylphenyl)-3-oxopentan-2-yl]-3-(4-fluorophenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 159292459 |
| Molecular Formula | C25H30FN3O2 |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | cis-(1R,3S)-N-[(2S)-5-(4-carbamimidoylphenyl)-3-oxopentan-2-yl]-3-(4-fluorophenyl)cyclohexane-1-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CCC(=O)[C@H](C)NC(=O)[C@@H]2CCC[C@H](c3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C25H30FN3O2/c1-16(23(30)14-7-17-5-8-19(9-6-17)24(27)28)29-25(31)21-4-2-3-20(15-21)18-10-12-22(26)13-11-18/h5-6,8-13,16,20-21H,2-4,7,14-15H2,1H3,(H3,27,28)(H,29,31)/t16-,20-,21+/m0/s1 |
| InChIKey | LQAUXQSAAHAYED-ORYQWCPZSA-N |
| XLogP | 4.09 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|