C25H31N3O2 — CID 162262767
cis-(1R,3S)-3-benzyl-N-[(2S)-5-(4-carbamimidoylphenyl)-3-oxopentan-2-yl]cyclopentane-1-carboxamide (PubChem CID 162262767) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is cis-(1R,3S)-3-benzyl-N-[(2S)-5-(4-carbamimidoylphenyl)-3-oxopentan-2-yl]cyclopentane-1-carboxamide.
| Compound Name | cis-(1R,3S)-3-benzyl-N-[(2S)-5-(4-carbamimidoylphenyl)-3-oxopentan-2-yl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 162262767 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | cis-(1R,3S)-3-benzyl-N-[(2S)-5-(4-carbamimidoylphenyl)-3-oxopentan-2-yl]cyclopentane-1-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CCC(=O)[C@H](C)NC(=O)[C@@H]2CC[C@H](Cc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C25H31N3O2/c1-17(23(29)14-10-18-7-11-21(12-8-18)24(26)27)28-25(30)22-13-9-20(16-22)15-19-5-3-2-4-6-19/h2-8,11-12,17,20,22H,9-10,13-16H2,1H3,(H3,26,27)(H,28,30)/t17-,20+,22+/m0/s1 |
| InChIKey | ZZMBDEKGKNEUPN-UCNVEGJOSA-N |
| XLogP | 3.64 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|