C32H39N3O3 — CID 158669430
(2R)-N-[(2S)-5-(4-carbamimidoylphenyl)-3-oxopentan-2-yl]-6-(4-hydroxyphenyl)-2-(2-phenylethyl)hexanamide (PubChem CID 158669430) has the molecular formula C32H39N3O3 and a molecular weight of 513.68 g/mol. Its IUPAC name is (2R)-N-[(2S)-5-(4-carbamimidoylphenyl)-3-oxopentan-2-yl]-6-(4-hydroxyphenyl)-2-(2-phenylethyl)hexanamide.
| Compound Name | (2R)-N-[(2S)-5-(4-carbamimidoylphenyl)-3-oxopentan-2-yl]-6-(4-hydroxyphenyl)-2-(2-phenylethyl)hexanamide |
|---|---|
| PubChem CID | 158669430 |
| Molecular Formula | C32H39N3O3 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | (2R)-N-[(2S)-5-(4-carbamimidoylphenyl)-3-oxopentan-2-yl]-6-(4-hydroxyphenyl)-2-(2-phenylethyl)hexanamide |
| SMILES | [H]/N=C(\N)c1ccc(CCC(=O)[C@H](C)NC(=O)[C@H](CCCCc2ccc(O)cc2)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C32H39N3O3/c1-23(30(37)22-16-26-11-17-27(18-12-26)31(33)34)35-32(38)28(19-13-24-7-3-2-4-8-24)10-6-5-9-25-14-20-29(36)21-15-25/h2-4,7-8,11-12,14-15,17-18,20-21,23,28,36H,5-6,9-10,13,16,19,22H2,1H3,(H3,33,34)(H,35,38)/t23-,28+/m0/s1 |
| InChIKey | IDTOFOOQODMCLF-NEKDWFFYSA-N |
| XLogP | 5.34 |
| TPSA | 116.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|