C16H23N3O4 — CID 15391511
(4R)-5-[4-(4-carbamimidoylphenyl)butylamino]-4-hydroxy-5-oxopentanoic acid (PubChem CID 15391511) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is (4R)-5-[4-(4-carbamimidoylphenyl)butylamino]-4-hydroxy-5-oxopentanoic acid.
| Compound Name | (4R)-5-[4-(4-carbamimidoylphenyl)butylamino]-4-hydroxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 15391511 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (4R)-5-[4-(4-carbamimidoylphenyl)butylamino]-4-hydroxy-5-oxopentanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(CCCCNC(=O)[C@H](O)CCC(=O)O)cc1 |
| InChI | InChI=1S/C16H23N3O4/c17-15(18)12-6-4-11(5-7-12)3-1-2-10-19-16(23)13(20)8-9-14(21)22/h4-7,13,20H,1-3,8-10H2,(H3,17,18)(H,19,23)(H,21,22)/t13-/m1/s1 |
| InChIKey | MIDVNFRBAXHWDP-CYBMUJFWSA-N |
| XLogP | 0.64 |
| TPSA | 136.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|