C15H21N5O4 — CID 73350148
(4S)-4-amino-5-[[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]amino]-5-oxopentanoic acid (PubChem CID 73350148) has the molecular formula C15H21N5O4 and a molecular weight of 335.36 g/mol. Its IUPAC name is (4S)-4-amino-5-[[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-4-amino-5-[[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 73350148 |
| Molecular Formula | C15H21N5O4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | (4S)-4-amino-5-[[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]amino]-5-oxopentanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)CNC(=O)[C@@H](N)CCC(=O)O)cc1 |
| InChI | InChI=1S/C15H21N5O4/c16-11(5-6-13(22)23)15(24)20-8-12(21)19-7-9-1-3-10(4-2-9)14(17)18/h1-4,11H,5-8,16H2,(H3,17,18)(H,19,21)(H,20,24)(H,22,23)/t11-/m0/s1 |
| InChIKey | SEXXIOSYTLBBPF-NSHDSACASA-N |
| XLogP | -1.10 |
| TPSA | 171.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|