C25H27ClN6O4 — CID 70089953
4-[1-[(4-carbamimidoylphenyl)methylamino]-2-oxo-2-[[2-oxo-2-(pyridin-4-ylmethylamino)ethyl]amino]ethyl]benzoic acid;hydrochloride (PubChem CID 70089953) has the molecular formula C25H27ClN6O4 and a molecular weight of 510.98 g/mol. Its IUPAC name is 4-[1-[(4-carbamimidoylphenyl)methylamino]-2-oxo-2-[[2-oxo-2-(pyridin-4-ylmethylamino)ethyl]amino]ethyl]benzoic acid;hydrochloride.
| Compound Name | 4-[1-[(4-carbamimidoylphenyl)methylamino]-2-oxo-2-[[2-oxo-2-(pyridin-4-ylmethylamino)ethyl]amino]ethyl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 70089953 |
| Molecular Formula | C25H27ClN6O4 |
| Molecular Weight | 510.98 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 4-[1-[(4-carbamimidoylphenyl)methylamino]-2-oxo-2-[[2-oxo-2-(pyridin-4-ylmethylamino)ethyl]amino]ethyl]benzoic acid;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(CNC(C(=O)NCC(=O)NCc2ccncc2)c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C25H26N6O4.ClH/c26-23(27)19-3-1-16(2-4-19)14-30-22(18-5-7-20(8-6-18)25(34)35)24(33)31-15-21(32)29-13-17-9-11-28-12-10-17;/h1-12,22,30H,13-15H2,(H3,26,27)(H,29,32)(H,31,33)(H,34,35);1H |
| InChIKey | NWMSQIAXKAXWPO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 170.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.98 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|