C34H38N6O4S — CID 24995153
(2R)-2-(benzylsulfonylamino)-N-[(2R)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxo-4-pyridin-4-ylbutan-2-yl]-4-phenylbutanamide (PubChem CID 24995153) has the molecular formula C34H38N6O4S and a molecular weight of 626.78 g/mol. Its IUPAC name is (2R)-2-(benzylsulfonylamino)-N-[(2R)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxo-4-pyridin-4-ylbutan-2-yl]-4-phenylbutanamide.
| Compound Name | (2R)-2-(benzylsulfonylamino)-N-[(2R)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxo-4-pyridin-4-ylbutan-2-yl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 24995153 |
| Molecular Formula | C34H38N6O4S |
| Molecular Weight | 626.78 g/mol |
| Exact Mass | 626.27 |
| IUPAC Name | (2R)-2-(benzylsulfonylamino)-N-[(2R)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxo-4-pyridin-4-ylbutan-2-yl]-4-phenylbutanamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@@H](CCc2ccncc2)NC(=O)[C@@H](CCc2ccccc2)NS(=O)(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C34H38N6O4S/c35-32(36)29-15-11-27(12-16-29)23-38-33(41)30(17-13-26-19-21-37-22-20-26)39-34(42)31(18-14-25-7-3-1-4-8-25)40-45(43,44)24-28-9-5-2-6-10-28/h1-12,15-16,19-22,30-31,40H,13-14,17-18,23-24H2,(H3,35,36)(H,38,41)(H,39,42)/t30-,31-/m1/s1 |
| InChIKey | DTIJCHDNBMFLKD-FIRIVFDPSA-N |
| XLogP | 3.22 |
| TPSA | 167.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.78 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|