C30H34N6O8S — CID 11479217
(4S)-5-[(4-carbamimidoylphenyl)methylamino]-4-[[(2R)-2-[(3-nitrophenyl)methylsulfonylamino]-4-phenylbutanoyl]amino]-5-oxopentanoic acid (PubChem CID 11479217) has the molecular formula C30H34N6O8S and a molecular weight of 638.70 g/mol. Its IUPAC name is (4S)-5-[(4-carbamimidoylphenyl)methylamino]-4-[[(2R)-2-[(3-nitrophenyl)methylsulfonylamino]-4-phenylbutanoyl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-5-[(4-carbamimidoylphenyl)methylamino]-4-[[(2R)-2-[(3-nitrophenyl)methylsulfonylamino]-4-phenylbutanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 11479217 |
| Molecular Formula | C30H34N6O8S |
| Molecular Weight | 638.70 g/mol |
| Exact Mass | 638.22 |
| IUPAC Name | (4S)-5-[(4-carbamimidoylphenyl)methylamino]-4-[[(2R)-2-[(3-nitrophenyl)methylsulfonylamino]-4-phenylbutanoyl]amino]-5-oxopentanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](CCc2ccccc2)NS(=O)(=O)Cc2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C30H34N6O8S/c31-28(32)23-12-9-21(10-13-23)18-33-29(39)25(15-16-27(37)38)34-30(40)26(14-11-20-5-2-1-3-6-20)35-45(43,44)19-22-7-4-8-24(17-22)36(41)42/h1-10,12-13,17,25-26,35H,11,14-16,18-19H2,(H3,31,32)(H,33,39)(H,34,40)(H,37,38)/t25-,26+/m0/s1 |
| InChIKey | ZTAWXPSQNLHNPZ-IZZNHLLZSA-N |
| XLogP | 1.97 |
| TPSA | 234.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.70 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|