C29H33N5O6S — CID 58834153
2-[4-[[(2R)-1-[[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]amino]-1-oxo-4-phenylbutan-2-yl]sulfamoylmethyl]phenyl]acetic acid (PubChem CID 58834153) has the molecular formula C29H33N5O6S and a molecular weight of 579.68 g/mol. Its IUPAC name is 2-[4-[[(2R)-1-[[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]amino]-1-oxo-4-phenylbutan-2-yl]sulfamoylmethyl]phenyl]acetic acid.
| Compound Name | 2-[4-[[(2R)-1-[[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]amino]-1-oxo-4-phenylbutan-2-yl]sulfamoylmethyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 58834153 |
| Molecular Formula | C29H33N5O6S |
| Molecular Weight | 579.68 g/mol |
| Exact Mass | 579.22 |
| IUPAC Name | 2-[4-[[(2R)-1-[[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]amino]-1-oxo-4-phenylbutan-2-yl]sulfamoylmethyl]phenyl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)CNC(=O)[C@@H](CCc2ccccc2)NS(=O)(=O)Cc2ccc(CC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C29H33N5O6S/c30-28(31)24-13-10-22(11-14-24)17-32-26(35)18-33-29(38)25(15-12-20-4-2-1-3-5-20)34-41(39,40)19-23-8-6-21(7-9-23)16-27(36)37/h1-11,13-14,25,34H,12,15-19H2,(H3,30,31)(H,32,35)(H,33,38)(H,36,37)/t25-/m1/s1 |
| InChIKey | NHJACAWOXPKYEO-RUZDIDTESA-N |
| XLogP | 1.45 |
| TPSA | 191.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.68 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|