C20H23N5O6S — CID 67302403
N-[2-[[(2R)-2-(benzylsulfonylamino)-3-hydroxypropanoyl]amino]acetyl]-4-carbamimidoylbenzamide (PubChem CID 67302403) has the molecular formula C20H23N5O6S and a molecular weight of 461.50 g/mol. Its IUPAC name is N-[2-[[(2R)-2-(benzylsulfonylamino)-3-hydroxypropanoyl]amino]acetyl]-4-carbamimidoylbenzamide.
| Compound Name | N-[2-[[(2R)-2-(benzylsulfonylamino)-3-hydroxypropanoyl]amino]acetyl]-4-carbamimidoylbenzamide |
|---|---|
| PubChem CID | 67302403 |
| Molecular Formula | C20H23N5O6S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | N-[2-[[(2R)-2-(benzylsulfonylamino)-3-hydroxypropanoyl]amino]acetyl]-4-carbamimidoylbenzamide |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)NC(=O)CNC(=O)[C@@H](CO)NS(=O)(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C20H23N5O6S/c21-18(22)14-6-8-15(9-7-14)19(28)24-17(27)10-23-20(29)16(11-26)25-32(30,31)12-13-4-2-1-3-5-13/h1-9,16,25-26H,10-12H2,(H3,21,22)(H,23,29)(H,24,27,28)/t16-/m1/s1 |
| InChIKey | VRXIOMDXKXCSPV-MRXNPFEDSA-N |
| XLogP | -1.18 |
| TPSA | 191.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|