C21H25N5O7S — CID 66752758
N-[(2S)-2-[[(2R)-2-(benzylsulfonylamino)-3-hydroxypropanoyl]amino]-3-hydroxypropanoyl]-4-carbamimidoylbenzamide (PubChem CID 66752758) has the molecular formula C21H25N5O7S and a molecular weight of 491.53 g/mol. Its IUPAC name is N-[(2S)-2-[[(2R)-2-(benzylsulfonylamino)-3-hydroxypropanoyl]amino]-3-hydroxypropanoyl]-4-carbamimidoylbenzamide.
| Compound Name | N-[(2S)-2-[[(2R)-2-(benzylsulfonylamino)-3-hydroxypropanoyl]amino]-3-hydroxypropanoyl]-4-carbamimidoylbenzamide |
|---|---|
| PubChem CID | 66752758 |
| Molecular Formula | C21H25N5O7S |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | N-[(2S)-2-[[(2R)-2-(benzylsulfonylamino)-3-hydroxypropanoyl]amino]-3-hydroxypropanoyl]-4-carbamimidoylbenzamide |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NS(=O)(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H25N5O7S/c22-18(23)14-6-8-15(9-7-14)19(29)25-20(30)16(10-27)24-21(31)17(11-28)26-34(32,33)12-13-4-2-1-3-5-13/h1-9,16-17,26-28H,10-12H2,(H3,22,23)(H,24,31)(H,25,29,30)/t16-,17+/m0/s1 |
| InChIKey | WNKKIGIJTAFFTB-DLBZAZTESA-N |
| XLogP | -1.82 |
| TPSA | 211.77 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|