C25H37N5O5S — CID 158014415
(2S)-2-[[(2R)-2-(benzylsulfonylamino)-3-hydroxybutanoyl]amino]-N-[(4-carbamimidoylphenyl)methyl]-4-methylpentanamide;molecular hydrogen (PubChem CID 158014415) has the molecular formula C25H37N5O5S and a molecular weight of 519.67 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-(benzylsulfonylamino)-3-hydroxybutanoyl]amino]-N-[(4-carbamimidoylphenyl)methyl]-4-methylpentanamide;molecular hydrogen.
| Compound Name | (2S)-2-[[(2R)-2-(benzylsulfonylamino)-3-hydroxybutanoyl]amino]-N-[(4-carbamimidoylphenyl)methyl]-4-methylpentanamide;molecular hydrogen |
|---|---|
| PubChem CID | 158014415 |
| Molecular Formula | C25H37N5O5S |
| Molecular Weight | 519.67 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | (2S)-2-[[(2R)-2-(benzylsulfonylamino)-3-hydroxybutanoyl]amino]-N-[(4-carbamimidoylphenyl)methyl]-4-methylpentanamide;molecular hydrogen |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@H](CC(C)C)NC(=O)[C@H](NS(=O)(=O)Cc2ccccc2)C(C)O)cc1.[H][H] |
| InChI | InChI=1S/C25H35N5O5S.H2/c1-16(2)13-21(24(32)28-14-18-9-11-20(12-10-18)23(26)27)29-25(33)22(17(3)31)30-36(34,35)15-19-7-5-4-6-8-19;/h4-12,16-17,21-22,30-31H,13-15H2,1-3H3,(H3,26,27)(H,28,32)(H,29,33);1H/t17?,21-,22+;/m0./s1 |
| InChIKey | FFGZZDIBVIXPEJ-DHKVGMDSSA-N |
| XLogP | 1.23 |
| TPSA | 174.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.67 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|