C26H35N5O7S — CID 11249961
3-[[(2R)-2-(benzylsulfonylamino)-3-[(2-methylpropan-2-yl)oxy]propanoyl]amino]-4-[(4-carbamimidoylphenyl)methylamino]-4-oxobutanoic acid (PubChem CID 11249961) has the molecular formula C26H35N5O7S and a molecular weight of 561.66 g/mol. Its IUPAC name is 3-[[(2R)-2-(benzylsulfonylamino)-3-[(2-methylpropan-2-yl)oxy]propanoyl]amino]-4-[(4-carbamimidoylphenyl)methylamino]-4-oxobutanoic acid.
| Compound Name | 3-[[(2R)-2-(benzylsulfonylamino)-3-[(2-methylpropan-2-yl)oxy]propanoyl]amino]-4-[(4-carbamimidoylphenyl)methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 11249961 |
| Molecular Formula | C26H35N5O7S |
| Molecular Weight | 561.66 g/mol |
| Exact Mass | 561.23 |
| IUPAC Name | 3-[[(2R)-2-(benzylsulfonylamino)-3-[(2-methylpropan-2-yl)oxy]propanoyl]amino]-4-[(4-carbamimidoylphenyl)methylamino]-4-oxobutanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)C(CC(=O)O)NC(=O)[C@@H](COC(C)(C)C)NS(=O)(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C26H35N5O7S/c1-26(2,3)38-15-21(31-39(36,37)16-18-7-5-4-6-8-18)25(35)30-20(13-22(32)33)24(34)29-14-17-9-11-19(12-10-17)23(27)28/h4-12,20-21,31H,13-16H2,1-3H3,(H3,27,28)(H,29,34)(H,30,35)(H,32,33)/t20?,21-/m1/s1 |
| InChIKey | UUADJFZGPRPRKW-BPGUCPLFSA-N |
| XLogP | 0.85 |
| TPSA | 200.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.66 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|