C36H41N5O4S — CID 24953669
2-(benzylsulfonylamino)-N-[1-[(4-carbamimidoylphenyl)methylamino]-1-oxo-4-phenylbutan-2-yl]-5-phenylpentanamide (PubChem CID 24953669) has the molecular formula C36H41N5O4S and a molecular weight of 639.82 g/mol. Its IUPAC name is 2-(benzylsulfonylamino)-N-[1-[(4-carbamimidoylphenyl)methylamino]-1-oxo-4-phenylbutan-2-yl]-5-phenylpentanamide.
| Compound Name | 2-(benzylsulfonylamino)-N-[1-[(4-carbamimidoylphenyl)methylamino]-1-oxo-4-phenylbutan-2-yl]-5-phenylpentanamide |
|---|---|
| PubChem CID | 24953669 |
| Molecular Formula | C36H41N5O4S |
| Molecular Weight | 639.82 g/mol |
| Exact Mass | 639.29 |
| IUPAC Name | 2-(benzylsulfonylamino)-N-[1-[(4-carbamimidoylphenyl)methylamino]-1-oxo-4-phenylbutan-2-yl]-5-phenylpentanamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)C(CCc2ccccc2)NC(=O)C(CCCc2ccccc2)NS(=O)(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C36H41N5O4S/c37-34(38)31-22-19-29(20-23-31)25-39-35(42)32(24-21-28-13-6-2-7-14-28)40-36(43)33(18-10-17-27-11-4-1-5-12-27)41-46(44,45)26-30-15-8-3-9-16-30/h1-9,11-16,19-20,22-23,32-33,41H,10,17-18,21,24-26H2,(H3,37,38)(H,39,42)(H,40,43) |
| InChIKey | YOEDIMJOIQFULT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 154.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.82 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|