C26H31N6O5S+ — CID 58834149
(2R)-N-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-2-[(1-hydroxypyridin-1-ium-4-yl)methylsulfonylamino]-4-phenylbutanamide (PubChem CID 58834149) has the molecular formula C26H31N6O5S+ and a molecular weight of 539.64 g/mol. Its IUPAC name is (2R)-N-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-2-[(1-hydroxypyridin-1-ium-4-yl)methylsulfonylamino]-4-phenylbutanamide.
| Compound Name | (2R)-N-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-2-[(1-hydroxypyridin-1-ium-4-yl)methylsulfonylamino]-4-phenylbutanamide |
|---|---|
| PubChem CID | 58834149 |
| Molecular Formula | C26H31N6O5S+ |
| Molecular Weight | 539.64 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | (2R)-N-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-2-[(1-hydroxypyridin-1-ium-4-yl)methylsulfonylamino]-4-phenylbutanamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)CNC(=O)[C@@H](CCc2ccccc2)NS(=O)(=O)Cc2cc[n+](O)cc2)cc1 |
| InChI | InChI=1S/C26H30N6O5S/c27-25(28)22-9-6-20(7-10-22)16-29-24(33)17-30-26(34)23(11-8-19-4-2-1-3-5-19)31-38(36,37)18-21-12-14-32(35)15-13-21/h1-7,9-10,12-15,23,31H,8,11,16-18H2,(H5-,27,28,29,30,33,34,35)/p+1/t23-/m1/s1 |
| InChIKey | OLAFOGVKPJSESC-HSZRJFAPSA-O |
| XLogP | 0.35 |
| TPSA | 178.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.64 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|