C35H47N7O6S — CID 24995156
tert-butyl N-[(5R)-5-(benzylsulfonylamino)-6-[[(2R)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxo-4-pyridin-4-ylbutan-2-yl]amino]-6-oxohexyl]carbamate (PubChem CID 24995156) has the molecular formula C35H47N7O6S and a molecular weight of 693.87 g/mol. Its IUPAC name is tert-butyl N-[(5R)-5-(benzylsulfonylamino)-6-[[(2R)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxo-4-pyridin-4-ylbutan-2-yl]amino]-6-oxohexyl]carbamate.
| Compound Name | tert-butyl N-[(5R)-5-(benzylsulfonylamino)-6-[[(2R)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxo-4-pyridin-4-ylbutan-2-yl]amino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 24995156 |
| Molecular Formula | C35H47N7O6S |
| Molecular Weight | 693.87 g/mol |
| Exact Mass | 693.33 |
| IUPAC Name | tert-butyl N-[(5R)-5-(benzylsulfonylamino)-6-[[(2R)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxo-4-pyridin-4-ylbutan-2-yl]amino]-6-oxohexyl]carbamate |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@@H](CCc2ccncc2)NC(=O)[C@@H](CCCCNC(=O)OC(C)(C)C)NS(=O)(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C35H47N7O6S/c1-35(2,3)48-34(45)39-20-8-7-11-30(42-49(46,47)24-27-9-5-4-6-10-27)33(44)41-29(17-14-25-18-21-38-22-19-25)32(43)40-23-26-12-15-28(16-13-26)31(36)37/h4-6,9-10,12-13,15-16,18-19,21-22,29-30,42H,7-8,11,14,17,20,23-24H2,1-3H3,(H3,36,37)(H,39,45)(H,40,43)(H,41,44)/t29-,30-/m1/s1 |
| InChIKey | YMIBWHDIUUMZFB-LOYHVIPDSA-N |
| XLogP | 3.28 |
| TPSA | 205.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.87 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|