C34H42N6O9S — CID 143015803
tert-butyl (4R)-5-[(4-carbamimidoylphenyl)methylamino]-4-[[(2R)-4-(4-hydroxyphenyl)-2-[(4-nitrophenyl)methylsulfonylamino]butanoyl]amino]-5-oxopentanoate (PubChem CID 143015803) has the molecular formula C34H42N6O9S and a molecular weight of 710.81 g/mol. Its IUPAC name is tert-butyl (4R)-5-[(4-carbamimidoylphenyl)methylamino]-4-[[(2R)-4-(4-hydroxyphenyl)-2-[(4-nitrophenyl)methylsulfonylamino]butanoyl]amino]-5-oxopentanoate.
| Compound Name | tert-butyl (4R)-5-[(4-carbamimidoylphenyl)methylamino]-4-[[(2R)-4-(4-hydroxyphenyl)-2-[(4-nitrophenyl)methylsulfonylamino]butanoyl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 143015803 |
| Molecular Formula | C34H42N6O9S |
| Molecular Weight | 710.81 g/mol |
| Exact Mass | 710.27 |
| IUPAC Name | tert-butyl (4R)-5-[(4-carbamimidoylphenyl)methylamino]-4-[[(2R)-4-(4-hydroxyphenyl)-2-[(4-nitrophenyl)methylsulfonylamino]butanoyl]amino]-5-oxopentanoate |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@@H](CCC(=O)OC(C)(C)C)NC(=O)[C@@H](CCc2ccc(O)cc2)NS(=O)(=O)Cc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C34H42N6O9S/c1-34(2,3)49-30(42)19-18-28(32(43)37-20-23-4-11-25(12-5-23)31(35)36)38-33(44)29(17-10-22-8-15-27(41)16-9-22)39-50(47,48)21-24-6-13-26(14-7-24)40(45)46/h4-9,11-16,28-29,39,41H,10,17-21H2,1-3H3,(H3,35,36)(H,37,43)(H,38,44)/t28-,29-/m1/s1 |
| InChIKey | LZFLFWJVPOMTLJ-FQLXRVMXSA-N |
| XLogP | 2.93 |
| TPSA | 243.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.81 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|