C39H45N5O8S — CID 88899331
benzyl (4S)-5-[[4-[(acetyloxyamino)-aminomethyl]phenyl]methylamino]-4-[[(2R)-2-(benzylsulfonylamino)-4-phenylbutanoyl]amino]-5-oxopentanoate (PubChem CID 88899331) has the molecular formula C39H45N5O8S and a molecular weight of 743.88 g/mol. Its IUPAC name is benzyl (4S)-5-[[4-[(acetyloxyamino)-aminomethyl]phenyl]methylamino]-4-[[(2R)-2-(benzylsulfonylamino)-4-phenylbutanoyl]amino]-5-oxopentanoate.
| Compound Name | benzyl (4S)-5-[[4-[(acetyloxyamino)-aminomethyl]phenyl]methylamino]-4-[[(2R)-2-(benzylsulfonylamino)-4-phenylbutanoyl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 88899331 |
| Molecular Formula | C39H45N5O8S |
| Molecular Weight | 743.88 g/mol |
| Exact Mass | 743.30 |
| IUPAC Name | benzyl (4S)-5-[[4-[(acetyloxyamino)-aminomethyl]phenyl]methylamino]-4-[[(2R)-2-(benzylsulfonylamino)-4-phenylbutanoyl]amino]-5-oxopentanoate |
| SMILES | CC(=O)ONC(N)c1ccc(CNC(=O)[C@H](CCC(=O)OCc2ccccc2)NC(=O)[C@@H](CCc2ccccc2)NS(=O)(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C39H45N5O8S/c1-28(45)52-43-37(40)33-20-17-30(18-21-33)25-41-38(47)34(23-24-36(46)51-26-31-13-7-3-8-14-31)42-39(48)35(22-19-29-11-5-2-6-12-29)44-53(49,50)27-32-15-9-4-10-16-32/h2-18,20-21,34-35,37,43-44H,19,22-27,40H2,1H3,(H,41,47)(H,42,48)/t34-,35+,37?/m0/s1 |
| InChIKey | NLUWLLMEZFYDAY-MQANMCDVSA-N |
| XLogP | 3.46 |
| TPSA | 195.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.88 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|