C27H34N4O7 — CID 88882645
benzyl (4S)-5-[[4-[(Z)-N'-acetyloxycarbamimidoyl]phenyl]methylamino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate (PubChem CID 88882645) has the molecular formula C27H34N4O7 and a molecular weight of 526.59 g/mol. Its IUPAC name is benzyl (4S)-5-[[4-[(Z)-N'-acetyloxycarbamimidoyl]phenyl]methylamino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate.
| Compound Name | benzyl (4S)-5-[[4-[(Z)-N'-acetyloxycarbamimidoyl]phenyl]methylamino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 88882645 |
| Molecular Formula | C27H34N4O7 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | benzyl (4S)-5-[[4-[(Z)-N'-acetyloxycarbamimidoyl]phenyl]methylamino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
| SMILES | CC(=O)O/N=C(\N)c1ccc(CNC(=O)[C@H](CCC(=O)OCc2ccccc2)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C27H34N4O7/c1-18(32)38-31-24(28)21-12-10-19(11-13-21)16-29-25(34)22(30-26(35)37-27(2,3)4)14-15-23(33)36-17-20-8-6-5-7-9-20/h5-13,22H,14-17H2,1-4H3,(H2,28,31)(H,29,34)(H,30,35)/t22-/m0/s1 |
| InChIKey | QRDJRXNGXSLIAB-QFIPXVFZSA-N |
| XLogP | 2.90 |
| TPSA | 158.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|