C34H40N4O9 — CID 10675734
benzyl (4S)-5-[(4-methoxyphenyl)methylamino]-4-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoyl]amino]-5-oxopentanoate (PubChem CID 10675734) has the molecular formula C34H40N4O9 and a molecular weight of 648.71 g/mol. Its IUPAC name is benzyl (4S)-5-[(4-methoxyphenyl)methylamino]-4-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoyl]amino]-5-oxopentanoate.
| Compound Name | benzyl (4S)-5-[(4-methoxyphenyl)methylamino]-4-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoyl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 10675734 |
| Molecular Formula | C34H40N4O9 |
| Molecular Weight | 648.71 g/mol |
| Exact Mass | 648.28 |
| IUPAC Name | benzyl (4S)-5-[(4-methoxyphenyl)methylamino]-4-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoyl]amino]-5-oxopentanoate |
| SMILES | COc1ccc(CNC(=O)[C@H](CCC(=O)OCc2ccccc2)NC(=O)[C@H](Cc2ccc([N+](=O)[O-])cc2)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C34H40N4O9/c1-34(2,3)47-33(42)37-29(20-23-10-14-26(15-11-23)38(43)44)32(41)36-28(18-19-30(39)46-22-25-8-6-5-7-9-25)31(40)35-21-24-12-16-27(45-4)17-13-24/h5-17,28-29H,18-22H2,1-4H3,(H,35,40)(H,36,41)(H,37,42)/t28-,29-/m0/s1 |
| InChIKey | PJRRQNAAUOWTLE-VMPREFPWSA-N |
| XLogP | 4.36 |
| TPSA | 175.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.71 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|