C28H36N4O7 — CID 155055916
benzyl (5S)-6-[[4-[(Z)-N'-acetyloxycarbamimidoyl]phenyl]methylamino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoate (PubChem CID 155055916) has the molecular formula C28H36N4O7 and a molecular weight of 540.62 g/mol. Its IUPAC name is benzyl (5S)-6-[[4-[(Z)-N'-acetyloxycarbamimidoyl]phenyl]methylamino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoate.
| Compound Name | benzyl (5S)-6-[[4-[(Z)-N'-acetyloxycarbamimidoyl]phenyl]methylamino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoate |
|---|---|
| PubChem CID | 155055916 |
| Molecular Formula | C28H36N4O7 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | benzyl (5S)-6-[[4-[(Z)-N'-acetyloxycarbamimidoyl]phenyl]methylamino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoate |
| SMILES | CC(=O)O/N=C(\N)c1ccc(CNC(=O)[C@H](CCCC(=O)OCc2ccccc2)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C28H36N4O7/c1-19(33)39-32-25(29)22-15-13-20(14-16-22)17-30-26(35)23(31-27(36)38-28(2,3)4)11-8-12-24(34)37-18-21-9-6-5-7-10-21/h5-7,9-10,13-16,23H,8,11-12,17-18H2,1-4H3,(H2,29,32)(H,30,35)(H,31,36)/t23-/m0/s1 |
| InChIKey | HMGARYQSWQUIFK-QHCPKHFHSA-N |
| XLogP | 3.29 |
| TPSA | 158.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|