C26H30N6O2S — CID 143015774
2-(benzylsulfanylamino)-N-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-4-pyridin-3-ylbutanamide (PubChem CID 143015774) has the molecular formula C26H30N6O2S and a molecular weight of 490.63 g/mol. Its IUPAC name is 2-(benzylsulfanylamino)-N-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-4-pyridin-3-ylbutanamide.
| Compound Name | 2-(benzylsulfanylamino)-N-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-4-pyridin-3-ylbutanamide |
|---|---|
| PubChem CID | 143015774 |
| Molecular Formula | C26H30N6O2S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 2-(benzylsulfanylamino)-N-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-4-pyridin-3-ylbutanamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)CNC(=O)C(CCc2cccnc2)NSCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H30N6O2S/c27-25(28)22-11-8-20(9-12-22)16-30-24(33)17-31-26(34)23(13-10-19-7-4-14-29-15-19)32-35-18-21-5-2-1-3-6-21/h1-9,11-12,14-15,23,32H,10,13,16-18H2,(H3,27,28)(H,30,33)(H,31,34) |
| InChIKey | QGDUFMWDEUYJDA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 132.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|