C28H35N5O2S — CID 143015781
2-(benzylsulfanylamino)-N-[2-[(4-methylphenyl)methylamino]-2-oxoethyl]-4-phenylbutanamide;methanimidamide (PubChem CID 143015781) has the molecular formula C28H35N5O2S and a molecular weight of 505.69 g/mol. Its IUPAC name is 2-(benzylsulfanylamino)-N-[2-[(4-methylphenyl)methylamino]-2-oxoethyl]-4-phenylbutanamide;methanimidamide.
| Compound Name | 2-(benzylsulfanylamino)-N-[2-[(4-methylphenyl)methylamino]-2-oxoethyl]-4-phenylbutanamide;methanimidamide |
|---|---|
| PubChem CID | 143015781 |
| Molecular Formula | C28H35N5O2S |
| Molecular Weight | 505.69 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | 2-(benzylsulfanylamino)-N-[2-[(4-methylphenyl)methylamino]-2-oxoethyl]-4-phenylbutanamide;methanimidamide |
| SMILES | Cc1ccc(CNC(=O)CNC(=O)C(CCc2ccccc2)NSCc2ccccc2)cc1.[H]/N=C/N |
| InChI | InChI=1S/C27H31N3O2S.CH4N2/c1-21-12-14-23(15-13-21)18-28-26(31)19-29-27(32)25(17-16-22-8-4-2-5-9-22)30-33-20-24-10-6-3-7-11-24;2-1-3/h2-15,25,30H,16-20H2,1H3,(H,28,31)(H,29,32);1H,(H3,2,3) |
| InChIKey | VRRQPMCGESHREP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 120.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.69 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|