C26H36N6O6S — CID 58594951
(2S)-2-[[(2R)-2-[(4-acetamidophenyl)sulfonylamino]-3-hydroxybutanoyl]amino]-N-[(4-carbamimidoylphenyl)methyl]-4-methylpentanamide (PubChem CID 58594951) has the molecular formula C26H36N6O6S and a molecular weight of 560.68 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-[(4-acetamidophenyl)sulfonylamino]-3-hydroxybutanoyl]amino]-N-[(4-carbamimidoylphenyl)methyl]-4-methylpentanamide.
| Compound Name | (2S)-2-[[(2R)-2-[(4-acetamidophenyl)sulfonylamino]-3-hydroxybutanoyl]amino]-N-[(4-carbamimidoylphenyl)methyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 58594951 |
| Molecular Formula | C26H36N6O6S |
| Molecular Weight | 560.68 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | (2S)-2-[[(2R)-2-[(4-acetamidophenyl)sulfonylamino]-3-hydroxybutanoyl]amino]-N-[(4-carbamimidoylphenyl)methyl]-4-methylpentanamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@H](CC(C)C)NC(=O)[C@H](NS(=O)(=O)c2ccc(NC(C)=O)cc2)C(C)O)cc1 |
| InChI | InChI=1S/C26H36N6O6S/c1-15(2)13-22(25(35)29-14-18-5-7-19(8-6-18)24(27)28)31-26(36)23(16(3)33)32-39(37,38)21-11-9-20(10-12-21)30-17(4)34/h5-12,15-16,22-23,32-33H,13-14H2,1-4H3,(H3,27,28)(H,29,35)(H,30,34)(H,31,36)/t16?,22-,23+/m0/s1 |
| InChIKey | MQJYNEVMOMUDJM-HHBYWCROSA-N |
| XLogP | 0.80 |
| TPSA | 203.57 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.68 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|