C24H26N4O3S — CID 73052178
N-[(4-carbamimidoylphenyl)methyl]-2-[4-(propan-2-ylsulfamoyl)phenyl]benzamide (PubChem CID 73052178) has the molecular formula C24H26N4O3S and a molecular weight of 450.56 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-2-[4-(propan-2-ylsulfamoyl)phenyl]benzamide.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-2-[4-(propan-2-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 73052178 |
| Molecular Formula | C24H26N4O3S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-2-[4-(propan-2-ylsulfamoyl)phenyl]benzamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)c2ccccc2-c2ccc(S(=O)(=O)NC(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H26N4O3S/c1-16(2)28-32(30,31)20-13-11-18(12-14-20)21-5-3-4-6-22(21)24(29)27-15-17-7-9-19(10-8-17)23(25)26/h3-14,16,28H,15H2,1-2H3,(H3,25,26)(H,27,29) |
| InChIKey | XRUOZVQYTYFHIV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 125.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|