C21H17N3O3S — CID 90070509
N-[(4-cyanophenyl)methyl]-2-(4-sulfamoylphenyl)benzamide (PubChem CID 90070509) has the molecular formula C21H17N3O3S and a molecular weight of 391.45 g/mol. Its IUPAC name is N-[(4-cyanophenyl)methyl]-2-(4-sulfamoylphenyl)benzamide.
| Compound Name | N-[(4-cyanophenyl)methyl]-2-(4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 90070509 |
| Molecular Formula | C21H17N3O3S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | N-[(4-cyanophenyl)methyl]-2-(4-sulfamoylphenyl)benzamide |
| SMILES | N#Cc1ccc(CNC(=O)c2ccccc2-c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C21H17N3O3S/c22-13-15-5-7-16(8-6-15)14-24-21(25)20-4-2-1-3-19(20)17-9-11-18(12-10-17)28(23,26)27/h1-12H,14H2,(H,24,25)(H2,23,26,27) |
| InChIKey | RCLUQJVJHZJLFW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |