C15H12N2O — CID 177456736
N-benzyl-4-cyano(111C)cyclohexa-1,3,5-triene-1-carboxamide (PubChem CID 177456736) has the molecular formula C15H12N2O and a molecular weight of 235.27 g/mol. Its IUPAC name is N-benzyl-4-cyano(111C)cyclohexa-1,3,5-triene-1-carboxamide.
| Compound Name | N-benzyl-4-cyano(111C)cyclohexa-1,3,5-triene-1-carboxamide |
|---|---|
| PubChem CID | 177456736 |
| Molecular Formula | C15H12N2O |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | N-benzyl-4-cyano(111C)cyclohexa-1,3,5-triene-1-carboxamide |
| SMILES | N#Cc1cc[11c](C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C15H12N2O/c16-10-12-6-8-14(9-7-12)15(18)17-11-13-4-2-1-3-5-13/h1-9H,11H2,(H,17,18)/i14-1 |
| InChIKey | ZXWNNGBHVOGRKO-UMSOTBISSA-N |
| XLogP | 2.49 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |