C18H17N5O — CID 73052491
N-[(4-carbamimidoylphenyl)methyl]-3-phenyl-1H-pyrazole-5-carboxamide (PubChem CID 73052491) has the molecular formula C18H17N5O and a molecular weight of 319.37 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-3-phenyl-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-3-phenyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 73052491 |
| Molecular Formula | C18H17N5O |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-3-phenyl-1H-pyrazole-5-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)c2cc(-c3ccccc3)n[nH]2)cc1 |
| InChI | InChI=1S/C18H17N5O/c19-17(20)14-8-6-12(7-9-14)11-21-18(24)16-10-15(22-23-16)13-4-2-1-3-5-13/h1-10H,11H2,(H3,19,20)(H,21,24)(H,22,23) |
| InChIKey | MXYSMFXMGAMBSF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 107.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|