C18H16N4OS — CID 24856375
N-[(4-carbamimidoylphenyl)methyl]-2-phenyl-1,3-thiazole-5-carboxamide (PubChem CID 24856375) has the molecular formula C18H16N4OS and a molecular weight of 336.42 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-2-phenyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-2-phenyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 24856375 |
| Molecular Formula | C18H16N4OS |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-2-phenyl-1,3-thiazole-5-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)c2cnc(-c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C18H16N4OS/c19-16(20)13-8-6-12(7-9-13)10-21-17(23)15-11-22-18(24-15)14-4-2-1-3-5-14/h1-9,11H,10H2,(H3,19,20)(H,21,23) |
| InChIKey | SXVATDMUEDFXIJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|