C16H21N3OS — CID 119643597
N-(2-amino-2-ethylbutyl)-2-phenyl-1,3-thiazole-5-carboxamide (PubChem CID 119643597) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-2-phenyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-amino-2-ethylbutyl)-2-phenyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 119643597 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-2-phenyl-1,3-thiazole-5-carboxamide |
| SMILES | CCC(N)(CC)CNC(=O)c1cnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C16H21N3OS/c1-3-16(17,4-2)11-19-14(20)13-10-18-15(21-13)12-8-6-5-7-9-12/h5-10H,3-4,11,17H2,1-2H3,(H,19,20) |
| InChIKey | VYFOGEQLOOYJOS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |