C16H18N2O3S — CID 119219821
6-[(2-phenyl-1,3-thiazole-5-carbonyl)amino]hexanoic acid (PubChem CID 119219821) has the molecular formula C16H18N2O3S and a molecular weight of 318.40 g/mol. Its IUPAC name is 6-[(2-phenyl-1,3-thiazole-5-carbonyl)amino]hexanoic acid.
| Compound Name | 6-[(2-phenyl-1,3-thiazole-5-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 119219821 |
| Molecular Formula | C16H18N2O3S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 6-[(2-phenyl-1,3-thiazole-5-carbonyl)amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)c1cnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C16H18N2O3S/c19-14(20)9-5-2-6-10-17-15(21)13-11-18-16(22-13)12-7-3-1-4-8-12/h1,3-4,7-8,11H,2,5-6,9-10H2,(H,17,21)(H,19,20) |
| InChIKey | QBBAAPFLXSRKJC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|