C15H24N2O3S — CID 120535642
8-[(2-propan-2-yl-1,3-thiazole-5-carbonyl)amino]octanoic acid (PubChem CID 120535642) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is 8-[(2-propan-2-yl-1,3-thiazole-5-carbonyl)amino]octanoic acid.
| Compound Name | 8-[(2-propan-2-yl-1,3-thiazole-5-carbonyl)amino]octanoic acid |
|---|---|
| PubChem CID | 120535642 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 8-[(2-propan-2-yl-1,3-thiazole-5-carbonyl)amino]octanoic acid |
| SMILES | CC(C)c1ncc(C(=O)NCCCCCCCC(=O)O)s1 |
| InChI | InChI=1S/C15H24N2O3S/c1-11(2)15-17-10-12(21-15)14(20)16-9-7-5-3-4-6-8-13(18)19/h10-11H,3-9H2,1-2H3,(H,16,20)(H,18,19) |
| InChIKey | MUCAPNRMHAYRGM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|