8-[(2-propan-2-yl-1,3-thiazole-5-carbonyl)amino]octanoic acid

C15H24N2O3S — CID 120535642

IUPAC8-[(2-propan-2-yl-1,3-thiazole-5-carbonyl)amino]octanoic acid
SMILESCC(C)c1ncc(C(=O)NCCCCCCCC(=O)O)s1
InChIInChI=1S/C15H24N2O3S/c1-11(2)15-17-10-12(21-15)14(20)16-9-7-5-3-4-6-8-13(18)19/h10-11H,3-9H2,1-2H3,(H,16,20)(H,18,19)
InChIKeyMUCAPNRMHAYRGM-UHFFFAOYSA-N
MW312.44 g/mol
LogP3.42
Rot. Bonds10

About 8-[(2-propan-2-yl-1,3-thiazole-5-carbonyl)amino]octanoic acid

8-[(2-propan-2-yl-1,3-thiazole-5-carbonyl)amino]octanoic acid (PubChem CID 120535642) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is 8-[(2-propan-2-yl-1,3-thiazole-5-carbonyl)amino]octanoic acid.

Molecular Properties

Compound Name8-[(2-propan-2-yl-1,3-thiazole-5-carbonyl)amino]octanoic acid
PubChem CID120535642
Molecular FormulaC15H24N2O3S
Molecular Weight312.44 g/mol
Exact Mass312.15
IUPAC Name8-[(2-propan-2-yl-1,3-thiazole-5-carbonyl)amino]octanoic acid
SMILESCC(C)c1ncc(C(=O)NCCCCCCCC(=O)O)s1
InChIInChI=1S/C15H24N2O3S/c1-11(2)15-17-10-12(21-15)14(20)16-9-7-5-3-4-6-8-13(18)19/h10-11H,3-9H2,1-2H3,(H,16,20)(H,18,19)
InChIKeyMUCAPNRMHAYRGM-UHFFFAOYSA-N
XLogP3.42
TPSA79.29 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds10
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500312.44
LogP ≤ 53.42
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 8-[(2-propan-2-yl-1,3-thiazole-5-carbonyl)amino]octanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 8-[(2-propan-2-yl-1,3-thiazole-5-carbonyl)amino]octanoic acid?
The IUPAC name of 8-[(2-propan-2-yl-1,3-thiazole-5-carbonyl)amino]octanoic acid (CID 120535642) is 8-[(2-propan-2-yl-1,3-thiazole-5-carbonyl)amino]octanoic acid.
What is the SMILES notation for 8-[(2-propan-2-yl-1,3-thiazole-5-carbonyl)amino]octanoic acid?
The canonical SMILES for 8-[(2-propan-2-yl-1,3-thiazole-5-carbonyl)amino]octanoic acid is CC(C)c1ncc(C(=O)NCCCCCCCC(=O)O)s1.
What is the InChIKey of 8-[(2-propan-2-yl-1,3-thiazole-5-carbonyl)amino]octanoic acid?
The InChIKey is MUCAPNRMHAYRGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O3S/c1-11(2)15-17-10-12(21-15)14(20)16-9-7-5-3-4-6-8-13(18)19/h10-11H,3-9H2,1-2H3,(H,16,20)(H,18,19).
What are the key properties of 8-[(2-propan-2-yl-1,3-thiazole-5-carbonyl)amino]octanoic acid?
8-[(2-propan-2-yl-1,3-thiazole-5-carbonyl)amino]octanoic acid has a molecular weight of 312.44 g/mol, XLogP of 3.42, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(2-propan-2-yl-1,3-thiazole-5-carbonyl)amino]octanoic acid is sourced from PubChem (CID 120535642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).